Products 1537422-34-6
CAS 1537422-34-6 is the registry number for cyclopropyl(4-fluoro-2-(trifluoromethyl)phenyl)methanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-[4-fluoro-2-(trifluoromethyl)phenyl]methanol (CAS 1537422-34-6) is a chemical compound with the molecular formula C11H10F4O and a molecular weight of 234.19 g/mol. IUPAC name: cyclopropyl-[4-fluoro-2-(trifluoromethyl)phenyl]methanol. InChIKey: KXMJIFVFCFTTTG-UHFFFAOYSA-N.
| Molecular formula | C11H10F4O |
|---|---|
| Molecular weight | 234.19 g/mol |
| IUPAC name | cyclopropyl-[4-fluoro-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | KXMJIFVFCFTTTG-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C=C(C=C2)F)C(F)(F)F)O |
Computed by PubChem (NCBI)