Products 153758-25-9
CAS 153758-25-9 is the registry number for Heparastatin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S,4S,5R,6R)-4,5-dihydroxy-6-[(2,2,2-trifluoroacetyl)amino]piperidine-3-carboxylic acid (CAS 153758-25-9) is a chemical compound with the molecular formula C8H11F3N2O5 and a molecular weight of 272.18 g/mol. IUPAC name: (3S,4S,5R,6R)-4,5-dihydroxy-6-[(2,2,2-trifluoroacetyl)amino]piperidine-3-carboxylic acid. InChIKey: UOPZEWVVILIZJY-NEEWWZBLSA-N.
| Molecular formula | C8H11F3N2O5 |
|---|---|
| Molecular weight | 272.18 g/mol |
| IUPAC name | (3S,4S,5R,6R)-4,5-dihydroxy-6-[(2,2,2-trifluoroacetyl)amino]piperidine-3-carboxylic acid |
| InChIKey | UOPZEWVVILIZJY-NEEWWZBLSA-N |
| SMILES | C1[C@@H]([C@@H]([C@@H]([C@H](N1)NC(=O)C(F)(F)F)O)O)C(=O)O |
Computed by PubChem (NCBI)