CAS 153776-41-1 is the registry number for 1,3-Dibromodithieno[3,4-b:3',2'-d]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dibromo-4,10-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,11-pentaene (CAS 153776-41-1) is a chemical compound with the molecular formula C9H3Br2NS2 and a molecular weight of 349.1 g/mol. IUPAC name: 3,5-dibromo-4,10-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,11-pentaene. InChIKey: FZJRIGKEYNXBCQ-UHFFFAOYSA-N.
| Molecular formula | C9H3Br2NS2 |
|---|---|
| Molecular weight | 349.1 g/mol |
| IUPAC name | 3,5-dibromo-4,10-dithia-7-azatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7,11-pentaene |
| InChIKey | FZJRIGKEYNXBCQ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C3=C(SC(=C3N=C2)Br)Br |
Computed by PubChem (NCBI)