CAS 1537764-34-3 is the registry number for 2-Bromo-1-(2-chloro-5-(methylthio)phenyl)ethanone. Offered by: TRC. Available pack sizes: 1g.
2-bromo-1-(2-chloro-5-methylsulfanylphenyl)ethanone (CAS 1537764-34-3) is a chemical compound with the molecular formula C9H8BrClOS and a molecular weight of 279.58 g/mol. IUPAC name: 2-bromo-1-(2-chloro-5-methylsulfanylphenyl)ethanone. InChIKey: AQKIBNVEBCCFCF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClOS |
|---|---|
| Molecular weight | 279.58 g/mol |
| IUPAC name | 2-bromo-1-(2-chloro-5-methylsulfanylphenyl)ethanone |
| InChIKey | AQKIBNVEBCCFCF-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=C(C=C1)Cl)C(=O)CBr |
Computed by PubChem (NCBI)