CAS 1537889-04-5 appears in our catalog under these names: (±)–UR–144 N–(4–hydroxypentyl) metabolite, N-(4-Hydroxypentyl) UR-144, Ur-144 N-(4-hydroxypentyl) metabolite. Offered by: GLPBio, TRC, Biosynth. Available pack sizes: 5mg, 250mg, 1mg, 10mg, 25mg, 50mg.
[1-(4-hydroxypentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (CAS 1537889-04-5) is a chemical compound with the molecular formula C21H29NO2 and a molecular weight of 327.5 g/mol. IUPAC name: [1-(4-hydroxypentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone. InChIKey: YHFHYHZNLCEAAP-UHFFFAOYSA-N.
| Molecular formula | C21H29NO2 |
|---|---|
| Molecular weight | 327.5 g/mol |
| IUPAC name | [1-(4-hydroxypentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| InChIKey | YHFHYHZNLCEAAP-UHFFFAOYSA-N |
| SMILES | CC(CCCN1C=C(C2=CC=CC=C21)C(=O)C3C(C3(C)C)(C)C)O |
Computed by PubChem (NCBI)