Products 1538065-39-2
CAS 1538065-39-2 is the registry number for 1-(3-Bromo-4-chlorophenyl)dihydropyrimidine-2,4(1H,3H)-dione, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3-bromo-4-chlorophenyl)-1,3-diazinane-2,4-dione (CAS 1538065-39-2) is a chemical compound with the molecular formula C10H8BrClN2O2 and a molecular weight of 303.54 g/mol. IUPAC name: 1-(3-bromo-4-chlorophenyl)-1,3-diazinane-2,4-dione. InChIKey: KYJIUTRDGHDNOG-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClN2O2 |
|---|---|
| Molecular weight | 303.54 g/mol |
| IUPAC name | 1-(3-bromo-4-chlorophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | KYJIUTRDGHDNOG-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=C(C=C2)Cl)Br |
Computed by PubChem (NCBI)