CAS 153894-28-1 is the registry number for Ethyl 6-tosyl-5,6-dihydro-4H-benzo[b]thieno[2,3-d]azepine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-(4-methylphenyl)sulfonyl-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate (CAS 153894-28-1) is a chemical compound with the molecular formula C22H21NO4S2 and a molecular weight of 427.5 g/mol. IUPAC name: ethyl 6-(4-methylphenyl)sulfonyl-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate. InChIKey: BVGPCZOOBZKZDF-UHFFFAOYSA-N.
| Molecular formula | C22H21NO4S2 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | ethyl 6-(4-methylphenyl)sulfonyl-4,5-dihydrothieno[3,2-d][1]benzazepine-2-carboxylate |
| InChIKey | BVGPCZOOBZKZDF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)C3=CC=CC=C3N(CC2)S(=O)(=O)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)