CAS 15390-25-7 is the registry number for 2,2-Difluoro-4,6-dimethyl-1,3,2-dioxaborine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2-difluoro-4,6-dimethyl-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene (CAS 15390-25-7) is a chemical compound with the molecular formula C5H7BF2O2 and a molecular weight of 147.92 g/mol. IUPAC name: 2,2-difluoro-4,6-dimethyl-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene. InChIKey: UAEGSWGMLVSQPF-UHFFFAOYSA-N.
| Molecular formula | C5H7BF2O2 |
|---|---|
| Molecular weight | 147.92 g/mol |
| IUPAC name | 2,2-difluoro-4,6-dimethyl-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene |
| InChIKey | UAEGSWGMLVSQPF-UHFFFAOYSA-N |
| SMILES | [B-]1(OC(=CC(=[O+]1)C)C)(F)F |
Computed by PubChem (NCBI)