CAS 1539318-36-9 appears in our catalog under these names: DFHBI 1T, DFHBI-1T/ 98.4% (existing batch purity), DFHBI-1T 99%, DFHBI-1T, 99%, 99%, DFHBI-1T (solution). Offered by: TRC, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 250mg.
(5Z)-5-[(3,5-difluoro-4-hydroxyphenyl)methylidene]-2-methyl-3-(2,2,2-trifluoroethyl)imidazol-4-one (CAS 1539318-36-9) is a chemical compound with the molecular formula C13H9F5N2O2 and a molecular weight of 320.21 g/mol. IUPAC name: (5Z)-5-[(3,5-difluoro-4-hydroxyphenyl)methylidene]-2-methyl-3-(2,2,2-trifluoroethyl)imidazol-4-one. InChIKey: AWYCLBWNRONMQC-WMZJFQQLSA-N.
| Molecular formula | C13H9F5N2O2 |
|---|---|
| Molecular weight | 320.21 g/mol |
| IUPAC name | (5Z)-5-[(3,5-difluoro-4-hydroxyphenyl)methylidene]-2-methyl-3-(2,2,2-trifluoroethyl)imidazol-4-one |
| InChIKey | AWYCLBWNRONMQC-WMZJFQQLSA-N |
| SMILES | CC1=N/C(=C\C2=CC(=C(C(=C2)F)O)F)/C(=O)N1CC(F)(F)F |
Computed by PubChem (NCBI)