Products 1539719-37-3

CAS 1539719-37-3 appears in our catalog under these names: 3-Chloro-4-(methylsulfanyl)benzene-1-sulfonyl chloride, 3-Chloro-4-(methylsulfanyl)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.

3-chloro-4-methylsulfanylbenzenesulfonyl chloride (CAS 1539719-37-3) is a chemical compound with the molecular formula C7H6Cl2O2S2 and a molecular weight of 257.2 g/mol. IUPAC name: 3-chloro-4-methylsulfanylbenzenesulfonyl chloride. InChIKey: PCZBNKRNIIFPCD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2O2S2
Molecular weight257.2 g/mol
IUPAC name3-chloro-4-methylsulfanylbenzenesulfonyl chloride
InChIKeyPCZBNKRNIIFPCD-UHFFFAOYSA-N
SMILESCSC1=C(C=C(C=C1)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)