CAS 154-69-8 appears in our catalog under these names: Chloropyramine Impurity 1 HCl (Tripelennamine HCl, Pyribenzamine HCl), Tripelennamine Hydrochloride, Tripelennamine hydrochloride 100 µg/mL in Acetonitrile, Tripelennamine hydrochloride/ 100%, Tripelennamine HCl. Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, Dr. Ehrenstorfer. Available pack sizes: on request, 10g, 1g, 50mg, 250mg, 10mg, 100mg, 1ml.
N'-benzyl-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride (CAS 154-69-8) is a chemical compound with the molecular formula C16H22ClN3 and a molecular weight of 291.82 g/mol. IUPAC name: N'-benzyl-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride. InChIKey: FSSICIQKZGUEAE-UHFFFAOYSA-N.
| Molecular formula | C16H22ClN3 |
|---|---|
| Molecular weight | 291.82 g/mol |
| IUPAC name | N'-benzyl-N,N-dimethyl-N'-pyridin-2-ylethane-1,2-diamine;hydrochloride |
| InChIKey | FSSICIQKZGUEAE-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(CC1=CC=CC=C1)C2=CC=CC=N2.Cl |
Computed by PubChem (NCBI)