CAS 154012-17-6 appears in our catalog under these names: 3-Pyridinecarboxylic acid, 4,6-dichloro-5-fluoro-, ethyl ester, 97%, 97%, Ethyl 4,6-dichloro-5-fluoronicotinate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 50mg.
Ethyl 4,6-dichloro-5-fluoropyridine-3-carboxylate (CAS 154012-17-6) is a chemical compound with the molecular formula C8H6Cl2FNO2 and a molecular weight of 238.04 g/mol. IUPAC name: ethyl 4,6-dichloro-5-fluoropyridine-3-carboxylate. InChIKey: PJAYGSDXQHYXNZ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2FNO2 |
|---|---|
| Molecular weight | 238.04 g/mol |
| IUPAC name | ethyl 4,6-dichloro-5-fluoropyridine-3-carboxylate |
| InChIKey | PJAYGSDXQHYXNZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C(=C1Cl)F)Cl |
Computed by PubChem (NCBI)