CAS 154016-23-6 appears in our catalog under these names: 4-Amino-5-(2-nitro-phenyl)-4h-[1,2,4]triazole-3-thiol, 92%, 4-Amino-5-(2-nitro-phenyl)-4h-(1,2,4)triazole-3-thiol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-amino-3-(2-nitrophenyl)-1H-1,2,4-triazole-5-thione (CAS 154016-23-6) is a chemical compound with the molecular formula C8H7N5O2S and a molecular weight of 237.24 g/mol. IUPAC name: 4-amino-3-(2-nitrophenyl)-1H-1,2,4-triazole-5-thione. InChIKey: HQDSMPOPMQMIGK-UHFFFAOYSA-N.
| Molecular formula | C8H7N5O2S |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | 4-amino-3-(2-nitrophenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | HQDSMPOPMQMIGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=S)N2N)[N+](=O)[O-] |
Computed by PubChem (NCBI)