CAS 154026-94-5 appears in our catalog under these names: (4R-Cis)-6-chloromethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid tert-butyl ester, 95%, Pitavastatin Impurity 20, (4R-cis)-6-Chloromethyl-2,2-dimethyl-1,3-dioxane-4-acetic Acid tert-Butyl Ester, tert-Butyl 2-((4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate 95% (stabilized with Cu+MgO), tert-Butyl 2-[(4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth, Ambeed. Available pack sizes: 1g, 5g, on request, 250mg, 500mg, 50mg, 1000mg.
Tert-butyl 2-[(4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 154026-94-5) is a chemical compound with the molecular formula C13H23ClO4 and a molecular weight of 278.77 g/mol. IUPAC name: tert-butyl 2-[(4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: TXLXWCARAPIXGH-ZJUUUORDSA-N.
| Molecular formula | C13H23ClO4 |
|---|---|
| Molecular weight | 278.77 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | TXLXWCARAPIXGH-ZJUUUORDSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CCl)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)