CAS 154026-98-9 is the registry number for tert-Butyl 2-((4R,6S)-6-(bromomethyl)-2,2-dimethyl-1,3-dioxan-4-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(4R,6S)-6-(bromomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 154026-98-9) is a chemical compound with the molecular formula C13H23BrO4 and a molecular weight of 323.22 g/mol. IUPAC name: tert-butyl 2-[(4R,6S)-6-(bromomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: JWMNVOWFLZUAPU-ZJUUUORDSA-N.
| Molecular formula | C13H23BrO4 |
|---|---|
| Molecular weight | 323.22 g/mol |
| IUPAC name | tert-butyl 2-[(4R,6S)-6-(bromomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | JWMNVOWFLZUAPU-ZJUUUORDSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CBr)CC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)