CAS 1540305-19-8 is the registry number for 3-((1,3-Dioxoisoindolin-2-yl)methyl)-5-fluorobenzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluorobenzonitrile (CAS 1540305-19-8) is a chemical compound with the molecular formula C16H9FN2O2 and a molecular weight of 280.25 g/mol. IUPAC name: 3-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluorobenzonitrile. InChIKey: PTLVTXIMQKJMCJ-UHFFFAOYSA-N.
| Molecular formula | C16H9FN2O2 |
|---|---|
| Molecular weight | 280.25 g/mol |
| IUPAC name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-5-fluorobenzonitrile |
| InChIKey | PTLVTXIMQKJMCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC(=CC(=C3)F)C#N |
Computed by PubChem (NCBI)