Products 154060-34-1
CAS 154060-34-1 appears in our catalog under these names: (5-Methoxypentyl)triphenylphosphonium bromide, ≥95%, (5-Methoxypentyl)triphenylphosphonium bromide, 95%, 95%, (5-Methoxypentyl)triphenylphosphonium bromide, 95%. Offered by: Fluorochem, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-methoxypentyl(triphenyl)phosphanium bromide (CAS 154060-34-1) is a chemical compound with the molecular formula C24H28BrOP and a molecular weight of 443.4 g/mol. IUPAC name: 5-methoxypentyl(triphenyl)phosphanium bromide. InChIKey: SHOUUNWCCLACFZ-UHFFFAOYSA-M.
| Molecular formula | C24H28BrOP |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | 5-methoxypentyl(triphenyl)phosphanium bromide |
| InChIKey | SHOUUNWCCLACFZ-UHFFFAOYSA-M |
| SMILES | COCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)