CAS 1540792-38-8 appears in our catalog under these names: (5,5-Dimethyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanamine, 95%, (5,5-Dimethyl-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg, 1000mg.
(5,5-dimethyl-6,7-dihydro-4H-1,2-benzoxazol-3-yl)methanamine (CAS 1540792-38-8) is a chemical compound with the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. IUPAC name: (5,5-dimethyl-6,7-dihydro-4H-1,2-benzoxazol-3-yl)methanamine. InChIKey: NFYZBRIHGUAAGV-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O |
|---|---|
| Molecular weight | 180.25 g/mol |
| IUPAC name | (5,5-dimethyl-6,7-dihydro-4H-1,2-benzoxazol-3-yl)methanamine |
| InChIKey | NFYZBRIHGUAAGV-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1)C(=NO2)CN)C |
Computed by PubChem (NCBI)