Products 1540803-64-2
CAS 1540803-64-2 is the registry number for (3-Fluoro-4-(furan-2-yl)phenyl)methanamine, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[3-fluoro-4-(furan-2-yl)phenyl]methanamine (CAS 1540803-64-2) is a chemical compound with the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. IUPAC name: [3-fluoro-4-(furan-2-yl)phenyl]methanamine. InChIKey: NYQQZQMJSRUIPW-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | [3-fluoro-4-(furan-2-yl)phenyl]methanamine |
| InChIKey | NYQQZQMJSRUIPW-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C(C=C(C=C2)CN)F |
Computed by PubChem (NCBI)