CAS 154116-31-1 is the registry number for CGS 26303. Offered by: MedChemExpress. Available pack sizes: Get quote.
[[(1S)-2-(4-phenylphenyl)-1-(2H-tetrazol-5-yl)ethyl]amino]methylphosphonic acid (CAS 154116-31-1) is a chemical compound with the molecular formula C16H18N5O3P and a molecular weight of 359.32 g/mol. IUPAC name: [[(1S)-2-(4-phenylphenyl)-1-(2H-tetrazol-5-yl)ethyl]amino]methylphosphonic acid. InChIKey: UUMKQZVEZSXWBY-HNNXBMFYSA-N.
| Molecular formula | C16H18N5O3P |
|---|---|
| Molecular weight | 359.32 g/mol |
| IUPAC name | [[(1S)-2-(4-phenylphenyl)-1-(2H-tetrazol-5-yl)ethyl]amino]methylphosphonic acid |
| InChIKey | UUMKQZVEZSXWBY-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C[C@@H](C3=NNN=N3)NCP(=O)(O)O |
Computed by PubChem (NCBI)