CAS 1541255-11-1 is the registry number for 3,5-dibromo-4-chlorobenzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
3,5-dibromo-4-chlorobenzonitrile (CAS 1541255-11-1) is a chemical compound with the molecular formula C7H2Br2ClN and a molecular weight of 295.36 g/mol. IUPAC name: 3,5-dibromo-4-chlorobenzonitrile. InChIKey: KXFQJADXZDMHDP-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2ClN |
|---|---|
| Molecular weight | 295.36 g/mol |
| IUPAC name | 3,5-dibromo-4-chlorobenzonitrile |
| InChIKey | KXFQJADXZDMHDP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Cl)Br)C#N |
Computed by PubChem (NCBI)