CAS 154131-00-7 is the registry number for PD 144418 Oxalate. Offered by: TRC. Available pack sizes: 250mg.
3-(4-methylphenyl)-5-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole;oxalic acid (CAS 154131-00-7) is a chemical compound with the molecular formula C20H24N2O5 and a molecular weight of 372.4 g/mol. IUPAC name: 3-(4-methylphenyl)-5-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole;oxalic acid. InChIKey: IWSFHSVGBKPYFN-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O5 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 3-(4-methylphenyl)-5-(1-propyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole;oxalic acid |
| InChIKey | IWSFHSVGBKPYFN-UHFFFAOYSA-N |
| SMILES | CCCN1CCC=C(C1)C2=CC(=NO2)C3=CC=C(C=C3)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)