CAS 154146-84-6 appears in our catalog under these names: Adenosine 2',5'–diphosphate sodium, ADENOSINE 2',5'-DIPHOSPHATE SODIUM&, Adenosine 2',5'-diphosphate (sodium), Adenosine 2',5'-diphosphate (sodium), 99.0%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 25MG, 5MG, 1 mg.
CAS 154146-84-6 identifies a chemical compound with the molecular formula C10H15N5NaO10P2 and a molecular weight of 450.19 g/mol. InChIKey: OHPUPSOOFQPMRP-MCDZGGTQSA-N.
| Molecular formula | C10H15N5NaO10P2 |
|---|---|
| Molecular weight | 450.19 g/mol |
| InChIKey | OHPUPSOOFQPMRP-MCDZGGTQSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)OP(=O)(O)O)N.[Na] |
Computed by PubChem (NCBI)