Products 1541667-98-4

CAS 1541667-98-4 is the registry number for 4-Chloro-5,6-dihydro-2H-pyran-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-chloro-3,6-dihydro-2H-pyran-5-carboxylic acid (CAS 1541667-98-4) is a chemical compound with the molecular formula C6H7ClO3 and a molecular weight of 162.57 g/mol. IUPAC name: 4-chloro-3,6-dihydro-2H-pyran-5-carboxylic acid. InChIKey: XJUOYDHZOSGHGV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClO3
Molecular weight162.57 g/mol
IUPAC name4-chloro-3,6-dihydro-2H-pyran-5-carboxylic acid
InChIKeyXJUOYDHZOSGHGV-UHFFFAOYSA-N
SMILESC1COCC(=C1Cl)C(=O)O

Computed by PubChem (NCBI)