Products 154187-50-5
CAS 154187-50-5 is the registry number for 2-Methoxy-4-[3-(trifluoromethyl)-3H-diazirin-3-yl]benzoic Acid, Methyl Ester, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-methoxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate (CAS 154187-50-5) is a chemical compound with the molecular formula C11H9F3N2O3 and a molecular weight of 274.20 g/mol. IUPAC name: methyl 2-methoxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate. InChIKey: IPQMAVSSCOHEMO-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O3 |
|---|---|
| Molecular weight | 274.20 g/mol |
| IUPAC name | methyl 2-methoxy-4-[3-(trifluoromethyl)diazirin-3-yl]benzoate |
| InChIKey | IPQMAVSSCOHEMO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2(N=N2)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)