CAS 154205-24-0 appears in our catalog under these names: 5,7-Dimethyl-1,2-dihydroquinolin-2-one, 95%, 5,7-Dimethyl-1,2-dihydroquinolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5,7-dimethyl-1H-quinolin-2-one (CAS 154205-24-0) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 5,7-dimethyl-1H-quinolin-2-one. InChIKey: QBWGUQQGLWSZKX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 5,7-dimethyl-1H-quinolin-2-one |
| InChIKey | QBWGUQQGLWSZKX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC(=O)NC2=C1)C |
Computed by PubChem (NCBI)