CAS 1542135-76-1 appears in our catalog under these names: LML134, LML134, 98%, LML134/ 99.86% (existing batch purity), LML134, ≥98%, ≥98%, LML134, 99.43%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 100mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100 mg.
[1-(1-methyl-6-oxopyridazin-3-yl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate (CAS 1542135-76-1) is a chemical compound with the molecular formula C19H29N5O3 and a molecular weight of 375.5 g/mol. IUPAC name: [1-(1-methyl-6-oxopyridazin-3-yl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate. InChIKey: BVUJMFFRMZRNAT-UHFFFAOYSA-N.
| Molecular formula | C19H29N5O3 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | [1-(1-methyl-6-oxopyridazin-3-yl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate |
| InChIKey | BVUJMFFRMZRNAT-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=CC(=N1)N2CCC(CC2)OC(=O)N3CCN(CC3)C4CCC4 |
Computed by PubChem (NCBI)