CAS 1542274-12-3 appears in our catalog under these names: (1,1':4',1''–Terphenyl)–2',3,3'',5,5',5''–hexacarboxylic acid, [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid, 98%, 98%, [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid, 95%, [1,1':4',1''-Terphenyl]-2',3,3'',5,5',5''-hexacarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
2,5-bis(3,5-dicarboxyphenyl)terephthalic acid (CAS 1542274-12-3) is a chemical compound with the molecular formula C24H14O12 and a molecular weight of 494.4 g/mol. IUPAC name: 2,5-bis(3,5-dicarboxyphenyl)terephthalic acid. InChIKey: WCMYVQOLWBUDDQ-UHFFFAOYSA-N.
| Molecular formula | C24H14O12 |
|---|---|
| Molecular weight | 494.4 g/mol |
| IUPAC name | 2,5-bis(3,5-dicarboxyphenyl)terephthalic acid |
| InChIKey | WCMYVQOLWBUDDQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C2=CC(=C(C=C2C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)