CAS 154228-18-9 is the registry number for Levofloxacin Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (E)-3-(dimethylamino)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enoate (CAS 154228-18-9) is a chemical compound with the molecular formula C14H13F4NO3 and a molecular weight of 319.25 g/mol. IUPAC name: ethyl (E)-3-(dimethylamino)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enoate. InChIKey: UINULXRKEQVJDQ-SOFGYWHQSA-N.
| Molecular formula | C14H13F4NO3 |
|---|---|
| Molecular weight | 319.25 g/mol |
| IUPAC name | ethyl (E)-3-(dimethylamino)-2-(2,3,4,5-tetrafluorobenzoyl)prop-2-enoate |
| InChIKey | UINULXRKEQVJDQ-SOFGYWHQSA-N |
| SMILES | CCOC(=O)/C(=C/N(C)C)/C(=O)C1=CC(=C(C(=C1F)F)F)F |
Computed by PubChem (NCBI)