Products 1542461-01-7
CAS 1542461-01-7 is the registry number for [2-Fluoro-5-(trifluoromethyl)phenyl]-1-piperidinylmethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
[2-fluoro-5-(trifluoromethyl)phenyl]-piperidin-1-ylmethanone (CAS 1542461-01-7) is a chemical compound with the molecular formula C13H13F4NO and a molecular weight of 275.24 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethyl)phenyl]-piperidin-1-ylmethanone. InChIKey: PGNRMCCMBNBYEW-UHFFFAOYSA-N.
| Molecular formula | C13H13F4NO |
|---|---|
| Molecular weight | 275.24 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethyl)phenyl]-piperidin-1-ylmethanone |
| InChIKey | PGNRMCCMBNBYEW-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=C(C=CC(=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)