CAS 15427-93-7 appears in our catalog under these names: NSC 109555, NSC 109555, NSC109555. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 50mg, 25mg, 10 mg, 5 mg.
1,3-bis[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea;methanesulfonic acid (CAS 15427-93-7) is a chemical compound with the molecular formula C21H32N10O7S2 and a molecular weight of 600.7 g/mol. IUPAC name: 1,3-bis[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea;methanesulfonic acid. InChIKey: HXDBGZUARNKHBV-XMDRLFCYSA-N.
| Molecular formula | C21H32N10O7S2 |
|---|---|
| Molecular weight | 600.7 g/mol |
| IUPAC name | 1,3-bis[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]urea;methanesulfonic acid |
| InChIKey | HXDBGZUARNKHBV-XMDRLFCYSA-N |
| SMILES | C/C(=N\N=C(N)N)/C1=CC=C(C=C1)NC(=O)NC2=CC=C(C=C2)/C(=N/N=C(N)N)/C.CS(=O)(=O)O.CS(=O)(=O)O |
Computed by PubChem (NCBI)