Products 1542853-00-8
CAS 1542853-00-8 is the registry number for 2-(2-Chloro-6-fluoro-3-methylphenyl)propan-2-ol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-(2-chloro-6-fluoro-3-methylphenyl)propan-2-ol (CAS 1542853-00-8) is a chemical compound with the molecular formula C10H12ClFO and a molecular weight of 202.65 g/mol. IUPAC name: 2-(2-chloro-6-fluoro-3-methylphenyl)propan-2-ol. InChIKey: YODVHVYGYUOJFY-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFO |
|---|---|
| Molecular weight | 202.65 g/mol |
| IUPAC name | 2-(2-chloro-6-fluoro-3-methylphenyl)propan-2-ol |
| InChIKey | YODVHVYGYUOJFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(C)(C)O)Cl |
Computed by PubChem (NCBI)