CAS 15432-56-1 appears in our catalog under these names: Copper(II)i–butyrate, Copper(II) isobutyrate 98%, Copper(II) isobutyrate, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 25g.
Copper bis(2-methylpropanoate) (CAS 15432-56-1) is a chemical compound with the molecular formula C8H14CuO4 and a molecular weight of 237.74 g/mol. IUPAC name: copper bis(2-methylpropanoate). InChIKey: KOKFUFYHQQCNNJ-UHFFFAOYSA-L.
| Molecular formula | C8H14CuO4 |
|---|---|
| Molecular weight | 237.74 g/mol |
| IUPAC name | copper bis(2-methylpropanoate) |
| InChIKey | KOKFUFYHQQCNNJ-UHFFFAOYSA-L |
| SMILES | CC(C)C(=O)[O-].CC(C)C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)