CAS 154335-57-6 appears in our catalog under these names: Camphor Impurity 15, (1S)-(+)-10-Camphorsulfonic Acid Ethyl Ester, >95% (GC), (1S)-(+)-10-Camphorsulfonic acid ethyl ester, Ethyl ((1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonate 95%, ethyl [(1S)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl]methanesulfonate, 95%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Fluorochem. Available pack sizes: on request, 2,5g, 250mg, 0,5g, 50mg, 1g, 100mg.
Ethyl [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate (CAS 154335-57-6) is a chemical compound with the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. IUPAC name: ethyl [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate. InChIKey: FXHGNNYOXDWQFY-BXKDBHETSA-N.
| Molecular formula | C12H20O4S |
|---|---|
| Molecular weight | 260.35 g/mol |
| IUPAC name | ethyl [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate |
| InChIKey | FXHGNNYOXDWQFY-BXKDBHETSA-N |
| SMILES | CCOS(=O)(=O)C[C@@]12CC[C@@H](C1(C)C)CC2=O |
Computed by PubChem (NCBI)