CAS 15435-29-7 appears in our catalog under these names: Bromochlorophen, 95%, Bromochlorophen, >95% (HPLC), 6,6'-Methylenebis(2-bromo-4-chlorophenol), 98%, Bromochlorophene, 2,2'–Methylenebis(6–bromo–4–chlorophenol) . Offered by: Combi-blocks, TRC, AmBeed, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 25g, 5g, 1g, 2,5g, 250mg, 500mg, 50mg, 1x50mg.
2-bromo-6-[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenol (CAS 15435-29-7) is a chemical compound with the molecular formula C13H8Br2Cl2O2 and a molecular weight of 426.9 g/mol. IUPAC name: 2-bromo-6-[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenol. InChIKey: TYBHZVUFOINFDV-UHFFFAOYSA-N.
| Molecular formula | C13H8Br2Cl2O2 |
|---|---|
| Molecular weight | 426.9 g/mol |
| IUPAC name | 2-bromo-6-[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenol |
| InChIKey | TYBHZVUFOINFDV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CC2=C(C(=CC(=C2)Cl)Br)O)O)Br)Cl |
Computed by PubChem (NCBI)