CAS 154361-53-2 appears in our catalog under these names: Iopromide EP Impurity G (Mixture of Diastereomers), Iopromide EP Impurity G, Iopromide Impurity 7 (Iopromide EP Impurity G). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-N-(2-chloro-3-hydroxypropyl)-3-N-(2,3-dihydroxypropyl)-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]-3-N-methylbenzene-1,3-dicarboxamide (CAS 154361-53-2) is a chemical compound with the molecular formula C18H23ClI3N3O7 and a molecular weight of 809.6 g/mol. IUPAC name: 1-N-(2-chloro-3-hydroxypropyl)-3-N-(2,3-dihydroxypropyl)-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]-3-N-methylbenzene-1,3-dicarboxamide. InChIKey: BPMVDBYYJLNLPG-UHFFFAOYSA-N.
| Molecular formula | C18H23ClI3N3O7 |
|---|---|
| Molecular weight | 809.6 g/mol |
| IUPAC name | 1-N-(2-chloro-3-hydroxypropyl)-3-N-(2,3-dihydroxypropyl)-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]-3-N-methylbenzene-1,3-dicarboxamide |
| InChIKey | BPMVDBYYJLNLPG-UHFFFAOYSA-N |
| SMILES | CN(CC(CO)O)C(=O)C1=C(C(=C(C(=C1I)C(=O)NCC(CO)Cl)I)NC(=O)COC)I |
Computed by PubChem (NCBI)