CAS 154362-03-5 appears in our catalog under these names: (Gly²¹)–Amyloid β–Protein (1–40), (Gly21)-Amyloid beta-Protein (1-40), (Gly21)-Amyloid b-Protein (1-40) trifluoroacetate salt. Offered by: GLPBio, Creative Peptides, Biosynth. Available pack sizes: 0,5mg, on request, 1mg, 500ug, 1000ug, 2000ug, 10000ug, 5000ug.
1-(4-cyano-2-methoxyphenyl)-4-fluoro-N-(1,2,4-thiadiazol-5-yl)isoquinoline-6-sulfonamide (CAS 154362-03-5) is a chemical compound with the molecular formula C19H12FN5O3S2 and a molecular weight of 441.5 g/mol. IUPAC name: 1-(4-cyano-2-methoxyphenyl)-4-fluoro-N-(1,2,4-thiadiazol-5-yl)isoquinoline-6-sulfonamide. InChIKey: DWAXYXVPNJLGHQ-UHFFFAOYSA-N.
| Molecular formula | C19H12FN5O3S2 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 1-(4-cyano-2-methoxyphenyl)-4-fluoro-N-(1,2,4-thiadiazol-5-yl)isoquinoline-6-sulfonamide |
| InChIKey | DWAXYXVPNJLGHQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C#N)C2=NC=C(C3=C2C=CC(=C3)S(=O)(=O)NC4=NC=NS4)F |
Computed by PubChem (NCBI)