CAS 154403-27-7 appears in our catalog under these names: 2,4,6-Tris(3,5-dimethyl-1H -pyrazol-1-yl)-1,3,5-triazine, 95%, 95%, 2,4,6-Tris(3,5-dimethyl-1H-pyrazol-1-yl)-1,3,5-triazine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,4,6-tris(3,5-dimethylpyrazol-1-yl)-1,3,5-triazine (CAS 154403-27-7) is a chemical compound with the molecular formula C18H21N9 and a molecular weight of 363.4 g/mol. IUPAC name: 2,4,6-tris(3,5-dimethylpyrazol-1-yl)-1,3,5-triazine. InChIKey: DGBHCVCPUCYWEM-UHFFFAOYSA-N.
| Molecular formula | C18H21N9 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 2,4,6-tris(3,5-dimethylpyrazol-1-yl)-1,3,5-triazine |
| InChIKey | DGBHCVCPUCYWEM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=NC(=NC(=N2)N3C(=CC(=N3)C)C)N4C(=CC(=N4)C)C)C |
Computed by PubChem (NCBI)