Products 15441-55-1

CAS 15441-55-1 is the registry number for 4,6-Dimethyl-1,3-dihydrothieno[3,4-c]thiophene 2-oxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,3-dimethyl-4,6-dihydrothieno[3,4-c]thiophene 5-oxide (CAS 15441-55-1) is a chemical compound with the molecular formula C8H10OS2 and a molecular weight of 186.3 g/mol. IUPAC name: 1,3-dimethyl-4,6-dihydrothieno[3,4-c]thiophene 5-oxide. InChIKey: ATTIDGJEEJUUOF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10OS2
Molecular weight186.3 g/mol
IUPAC name1,3-dimethyl-4,6-dihydrothieno[3,4-c]thiophene 5-oxide
InChIKeyATTIDGJEEJUUOF-UHFFFAOYSA-N
SMILESCC1=C2CS(=O)CC2=C(S1)C

Computed by PubChem (NCBI)