Products 1544601-57-1

CAS 1544601-57-1 is the registry number for Ketoprofen D-Lysinate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3-benzoylphenyl)propanoic acid;(2S)-2,6-diaminohexanoic acid (CAS 1544601-57-1) is a chemical compound with the molecular formula C22H28N2O5 and a molecular weight of 400.5 g/mol. IUPAC name: 2-(3-benzoylphenyl)propanoic acid;(2S)-2,6-diaminohexanoic acid. InChIKey: VHIORVCHBUEWEP-ZSCHJXSPSA-N.

Identity
Molecular formulaC22H28N2O5
Molecular weight400.5 g/mol
IUPAC name2-(3-benzoylphenyl)propanoic acid;(2S)-2,6-diaminohexanoic acid
InChIKeyVHIORVCHBUEWEP-ZSCHJXSPSA-N
SMILESCC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)O.C(CCN)C[C@@H](C(=O)O)N

Computed by PubChem (NCBI)