CAS 154474-91-6 is the registry number for 1-((3-{((Diaminomethylidene)amino)methyl}phenyl)methyl)guanidine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[[3-[(diaminomethylideneamino)methyl]phenyl]methyl]guanidine;dihydrochloride (CAS 154474-91-6) is a chemical compound with the molecular formula C10H18Cl2N6 and a molecular weight of 293.19 g/mol. IUPAC name: 2-[[3-[(diaminomethylideneamino)methyl]phenyl]methyl]guanidine;dihydrochloride. InChIKey: GMLBOUPTOPTITO-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N6 |
|---|---|
| Molecular weight | 293.19 g/mol |
| IUPAC name | 2-[[3-[(diaminomethylideneamino)methyl]phenyl]methyl]guanidine;dihydrochloride |
| InChIKey | GMLBOUPTOPTITO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)CN=C(N)N)CN=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)