CAS 1544740-15-9 is the registry number for 2-Bromo-5-[(3,3-difluorocyclobutyl)methoxy]-1,3-dimethylbenzene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-[(3,3-difluorocyclobutyl)methoxy]-1,3-dimethylbenzene (CAS 1544740-15-9) is a chemical compound with the molecular formula C13H15BrF2O and a molecular weight of 305.16 g/mol. IUPAC name: 2-bromo-5-[(3,3-difluorocyclobutyl)methoxy]-1,3-dimethylbenzene. InChIKey: UPSVZTZMRMABIP-UHFFFAOYSA-N.
| Molecular formula | C13H15BrF2O |
|---|---|
| Molecular weight | 305.16 g/mol |
| IUPAC name | 2-bromo-5-[(3,3-difluorocyclobutyl)methoxy]-1,3-dimethylbenzene |
| InChIKey | UPSVZTZMRMABIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)OCC2CC(C2)(F)F |
Computed by PubChem (NCBI)