CAS 154483-81-5 is the registry number for Boc-4-phosphono-Phe(Et)2-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: 250mg, 1g, 25mg.
(2S)-3-(4-diethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 154483-81-5) is a chemical compound with the molecular formula C18H28NO7P and a molecular weight of 401.4 g/mol. IUPAC name: (2S)-3-(4-diethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: YIIIAFPKBOKZSW-HNNXBMFYSA-N.
| Molecular formula | C18H28NO7P |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | (2S)-3-(4-diethoxyphosphorylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | YIIIAFPKBOKZSW-HNNXBMFYSA-N |
| SMILES | CCOP(=O)(C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)OCC |
Computed by PubChem (NCBI)