CAS 154500-46-6 is the registry number for bis(2,3,4-Trichlorophenyl)iodonium Sulfate. Offered by: TRC. Available pack sizes: 100mg.
Bis(2,3,4-trichlorophenyl)iodanium;hydrogen sulfate (CAS 154500-46-6) is a chemical compound with the molecular formula C12H5Cl6IO4S and a molecular weight of 584.8 g/mol. IUPAC name: bis(2,3,4-trichlorophenyl)iodanium;hydrogen sulfate. InChIKey: WRZJQGXWJBSQDC-UHFFFAOYSA-M.
| Molecular formula | C12H5Cl6IO4S |
|---|---|
| Molecular weight | 584.8 g/mol |
| IUPAC name | bis(2,3,4-trichlorophenyl)iodanium;hydrogen sulfate |
| InChIKey | WRZJQGXWJBSQDC-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C(=C1Cl)Cl)Cl)[I+]C2=C(C(=C(C=C2)Cl)Cl)Cl.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)