CAS 1545412-45-0 appears in our catalog under these names: Methyl 5-Iodoimidazo(2,1-B)(1,3)thiazole-2-carboxylate, Methyl 5-iodoimidazo(2,1-b)(1,3)thiazole-2-carboxylate, 95%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 0,5g, 50mg.
Methyl 5-iodoimidazo[2,1-b][1,3]thiazole-2-carboxylate (CAS 1545412-45-0) is a chemical compound with the molecular formula C7H5IN2O2S and a molecular weight of 308.10 g/mol. IUPAC name: methyl 5-iodoimidazo[2,1-b][1,3]thiazole-2-carboxylate. InChIKey: VUFXVSOUPSXEJQ-UHFFFAOYSA-N.
| Molecular formula | C7H5IN2O2S |
|---|---|
| Molecular weight | 308.10 g/mol |
| IUPAC name | methyl 5-iodoimidazo[2,1-b][1,3]thiazole-2-carboxylate |
| InChIKey | VUFXVSOUPSXEJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=CN=C2S1)I |
Computed by PubChem (NCBI)