CAS 1545468-80-1 is the registry number for Carfilzomib Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2S)-2-[[(2S)-2-amino-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid (CAS 1545468-80-1) is a chemical compound with the molecular formula C25H33N3O4 and a molecular weight of 439.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[[(2S)-2-amino-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid. InChIKey: CSHVCQGQEPISTJ-FKBYEOEOSA-N.
| Molecular formula | C25H33N3O4 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | CSHVCQGQEPISTJ-FKBYEOEOSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)[C@H](CCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)