CAS 154564-03-1 appears in our catalog under these names: H–Asp–pNA · HCl, (S)-3-Amino-4-((4-nitrophenyl)amino)-4-oxobutanoic acid hydrochloride, 95%, H-L-Asp-pNA*HCl, H-Asp-pNA·HCl, H-Asp-pNA·HCl 95%. Offered by: GLPBio, Combi-blocks, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 1000mg.
(3S)-3-amino-4-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride (CAS 154564-03-1) is a chemical compound with the molecular formula C10H12ClN3O5 and a molecular weight of 289.67 g/mol. IUPAC name: (3S)-3-amino-4-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride. InChIKey: VVZGJGYVGBGMRI-QRPNPIFTSA-N.
| Molecular formula | C10H12ClN3O5 |
|---|---|
| Molecular weight | 289.67 g/mol |
| IUPAC name | (3S)-3-amino-4-(4-nitroanilino)-4-oxobutanoic acid;hydrochloride |
| InChIKey | VVZGJGYVGBGMRI-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)[C@H](CC(=O)O)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)