CAS 154592-20-8 appears in our catalog under these names: Copper pyrithione, 95%, Copper pyrithione, Copper pyrithione 95%, Copper pyrithione, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 2g, 10g, 50g, 100mg, 250mg.
Copper;bis(1-hydroxypyridine-2-thione) (CAS 154592-20-8) is a chemical compound with the molecular formula C10H10CuN2O2S2 and a molecular weight of 317.9 g/mol. IUPAC name: copper;bis(1-hydroxypyridine-2-thione). InChIKey: QHNCWVQDOPICKC-UHFFFAOYSA-N.
| Molecular formula | C10H10CuN2O2S2 |
|---|---|
| Molecular weight | 317.9 g/mol |
| IUPAC name | copper;bis(1-hydroxypyridine-2-thione) |
| InChIKey | QHNCWVQDOPICKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=S)N(C=C1)O.C1=CC(=S)N(C=C1)O.[Cu] |
Computed by PubChem (NCBI)