CAS 1546589-07-4 appears in our catalog under these names: 3-((4-Chlorophenyl)sulfanyl)-2-nitrobenzoic acid, 3-((4-Chlorophenyl)sulfanyl)-2-nitrobenzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
3-(4-chlorophenyl)sulfanyl-2-nitrobenzoic acid (CAS 1546589-07-4) is a chemical compound with the molecular formula C13H8ClNO4S and a molecular weight of 309.73 g/mol. IUPAC name: 3-(4-chlorophenyl)sulfanyl-2-nitrobenzoic acid. InChIKey: SMHSWJKAMYLBCR-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO4S |
|---|---|
| Molecular weight | 309.73 g/mol |
| IUPAC name | 3-(4-chlorophenyl)sulfanyl-2-nitrobenzoic acid |
| InChIKey | SMHSWJKAMYLBCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)SC2=CC=C(C=C2)Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)