Products 1546958-77-3
CAS 1546958-77-3 is the registry number for (3-Bromo-4-chlorophenyl)(phenyl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3-bromo-4-chlorophenyl)-phenylmethanol (CAS 1546958-77-3) is a chemical compound with the molecular formula C13H10BrClO and a molecular weight of 297.57 g/mol. IUPAC name: (3-bromo-4-chlorophenyl)-phenylmethanol. InChIKey: GPRDPOCYKSCAPJ-UHFFFAOYSA-N.
| Molecular formula | C13H10BrClO |
|---|---|
| Molecular weight | 297.57 g/mol |
| IUPAC name | (3-bromo-4-chlorophenyl)-phenylmethanol |
| InChIKey | GPRDPOCYKSCAPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=C(C=C2)Cl)Br)O |
Computed by PubChem (NCBI)